C22H28N2O2 — CID 93076830
(2S)-N-[(3-methoxyphenyl)methyl]-2-(3-methylphenyl)azepane-1-carboxamide (PubChem CID 93076830) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2S)-N-[(3-methoxyphenyl)methyl]-2-(3-methylphenyl)azepane-1-carboxamide.
| Compound Name | (2S)-N-[(3-methoxyphenyl)methyl]-2-(3-methylphenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 93076830 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2S)-N-[(3-methoxyphenyl)methyl]-2-(3-methylphenyl)azepane-1-carboxamide |
| SMILES | COc1cccc(CNC(=O)N2CCCCC[C@H]2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-17-8-6-10-19(14-17)21-12-4-3-5-13-24(21)22(25)23-16-18-9-7-11-20(15-18)26-2/h6-11,14-15,21H,3-5,12-13,16H2,1-2H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | IFIHFJDICRRBRY-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |