C20H22F2N2O — CID 93076835
(2R)-N-(2,4-difluorophenyl)-2-(4-methylphenyl)azepane-1-carboxamide (PubChem CID 93076835) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R)-N-(2,4-difluorophenyl)-2-(4-methylphenyl)azepane-1-carboxamide.
| Compound Name | (2R)-N-(2,4-difluorophenyl)-2-(4-methylphenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 93076835 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2R)-N-(2,4-difluorophenyl)-2-(4-methylphenyl)azepane-1-carboxamide |
| SMILES | Cc1ccc([C@H]2CCCCCN2C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H22F2N2O/c1-14-6-8-15(9-7-14)19-5-3-2-4-12-24(19)20(25)23-18-11-10-16(21)13-17(18)22/h6-11,13,19H,2-5,12H2,1H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | VLBVIIVOQUSDMK-LJQANCHMSA-N |
| XLogP | 5.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |