C10H14Cl2N2O3S — CID 93081169
4-amino-2,6-dichloro-N-[(2S)-1-hydroxybutan-2-yl]benzenesulfonamide (PubChem CID 93081169) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-[(2S)-1-hydroxybutan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-[(2S)-1-hydroxybutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 93081169 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-amino-2,6-dichloro-N-[(2S)-1-hydroxybutan-2-yl]benzenesulfonamide |
| SMILES | CC[C@@H](CO)NS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-2-7(5-15)14-18(16,17)10-8(11)3-6(13)4-9(10)12/h3-4,7,14-15H,2,5,13H2,1H3/t7-/m0/s1 |
| InChIKey | YOUYMFMFHWBZNX-ZETCQYMHSA-N |
| XLogP | 1.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|