C13H16BrNO3 — CID 93083252
2-bromo-N-[2-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide (PubChem CID 93083252) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-bromo-N-[2-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide.
| Compound Name | 2-bromo-N-[2-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 93083252 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-bromo-N-[2-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
| SMILES | O=C(CBr)Nc1ccccc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H16BrNO3/c14-8-13(16)15-11-5-1-2-6-12(11)18-9-10-4-3-7-17-10/h1-2,5-6,10H,3-4,7-9H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | AGGKSVJEGVKIDI-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|