C19H24N2O5S — CID 9309341
[(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetate (PubChem CID 9309341) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetate.
| Compound Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 9309341 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2R)-1-oxo-1-(propylamino)propan-2-yl] 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetate |
| SMILES | CCCNC(=O)[C@@H](C)OC(=O)CN(C)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H24N2O5S/c1-4-11-20-19(23)14(2)26-18(22)13-21(3)27(24,25)17-10-9-15-7-5-6-8-16(15)12-17/h5-10,12,14H,4,11,13H2,1-3H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | NZOIBJVGORRIBY-CQSZACIVSA-N |
| XLogP | 1.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |