C28H27FN4O3S — CID 93101472
4-butoxy-N-[(2R)-1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide (PubChem CID 93101472) has the molecular formula C28H27FN4O3S and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-butoxy-N-[(2R)-1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[(2R)-1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 93101472 |
| Molecular Formula | C28H27FN4O3S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 4-butoxy-N-[(2R)-1-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N[C@H](Cc2ccccc2)C(=O)Nc2nnc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C28H27FN4O3S/c1-2-3-17-36-23-15-11-20(12-16-23)25(34)30-24(18-19-7-5-4-6-8-19)26(35)31-28-33-32-27(37-28)21-9-13-22(29)14-10-21/h4-16,24H,2-3,17-18H2,1H3,(H,30,34)(H,31,33,35)/t24-/m1/s1 |
| InChIKey | MGJYFDYSRZMFCD-XMMPIXPASA-N |
| XLogP | 5.50 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|