About 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole
5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole (PubChem CID 93105065) has the molecular formula C9H14ClNO
and a molecular weight of 187.67 g/mol. Its IUPAC name is 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole |
| PubChem CID | 93105065 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole |
| SMILES | C[C@@H](Cl)c1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C9H14ClNO/c1-6(10)8-11-5-7(12-8)9(2,3)4/h5-6H,1-4H3/t6-/m1/s1 |
| InChIKey | NGJCDWDWDLCMNH-ZCFIWIBFSA-N |
| XLogP | 3.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole?
The IUPAC name of 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole (CID 93105065) is 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole.
What is the SMILES notation for 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole?
The canonical SMILES for 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole is C[C@@H](Cl)c1ncc(C(C)(C)C)o1.
What is the InChIKey of 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole?
The InChIKey is NGJCDWDWDLCMNH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H14ClNO/c1-6(10)8-11-5-7(12-8)9(2,3)4/h5-6H,1-4H3/t6-/m1/s1.
What are the key properties of 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole?
5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole has a molecular weight of 187.67 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-[(1R)-1-chloroethyl]-1,3-oxazole is sourced from PubChem (CID 93105065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).