C14H17FN2O — CID 93114266
(3R)-1-(3-fluorophenyl)-3-methyl-4-prop-2-enylpiperazin-2-one (PubChem CID 93114266) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is (3R)-1-(3-fluorophenyl)-3-methyl-4-prop-2-enylpiperazin-2-one.
| Compound Name | (3R)-1-(3-fluorophenyl)-3-methyl-4-prop-2-enylpiperazin-2-one |
|---|---|
| PubChem CID | 93114266 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (3R)-1-(3-fluorophenyl)-3-methyl-4-prop-2-enylpiperazin-2-one |
| SMILES | C=CCN1CCN(c2cccc(F)c2)C(=O)[C@H]1C |
| InChI | InChI=1S/C14H17FN2O/c1-3-7-16-8-9-17(14(18)11(16)2)13-6-4-5-12(15)10-13/h3-6,10-11H,1,7-9H2,2H3/t11-/m1/s1 |
| InChIKey | ZMMNIVRGCDQUPC-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|