About 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine
4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine (PubChem CID 9311493) has the molecular formula C23H24N5S+
and a molecular weight of 402.55 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
| PubChem CID | 9311493 |
| Molecular Formula | C23H24N5S+ |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine |
| SMILES | C[NH+]1CCCN(c2nc(-c3ccccn3)nc3scc(-c4ccccc4)c23)CC1 |
| InChI | InChI=1S/C23H23N5S/c1-27-12-7-13-28(15-14-27)22-20-18(17-8-3-2-4-9-17)16-29-23(20)26-21(25-22)19-10-5-6-11-24-19/h2-6,8-11,16H,7,12-15H2,1H3/p+1 |
| InChIKey | SWRLQXJBLLCZTD-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine (CID 9311493) is 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine is C[NH+]1CCCN(c2nc(-c3ccccn3)nc3scc(-c4ccccc4)c23)CC1.
What is the InChIKey of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
The InChIKey is SWRLQXJBLLCZTD-UHFFFAOYSA-O. The full InChI is InChI=1S/C23H23N5S/c1-27-12-7-13-28(15-14-27)22-20-18(17-8-3-2-4-9-17)16-29-23(20)26-21(25-22)19-10-5-6-11-24-19/h2-6,8-11,16H,7,12-15H2,1H3/p+1.
What are the key properties of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine?
4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine has a molecular weight of 402.55 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)-5-phenyl-2-pyridin-2-ylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 9311493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).