About 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide
4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide (PubChem CID 93116099) has the molecular formula C12H15BrN2O
and a molecular weight of 283.17 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide.
Molecular Properties
| Compound Name | 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide |
| PubChem CID | 93116099 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide |
| SMILES | CC(C)(C)/C=N\NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H15BrN2O/c1-12(2,3)8-14-15-11(16)9-4-6-10(13)7-5-9/h4-8H,1-3H3,(H,15,16)/b14-8- |
| InChIKey | QCAVFRQDEWNVEC-ZSOIEALJSA-N |
| XLogP | 3.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide?
The IUPAC name of 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide (CID 93116099) is 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide.
What is the SMILES notation for 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide?
The canonical SMILES for 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide is CC(C)(C)/C=N\NC(=O)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide?
The InChIKey is QCAVFRQDEWNVEC-ZSOIEALJSA-N. The full InChI is InChI=1S/C12H15BrN2O/c1-12(2,3)8-14-15-11(16)9-4-6-10(13)7-5-9/h4-8H,1-3H3,(H,15,16)/b14-8-.
What are the key properties of 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide?
4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide has a molecular weight of 283.17 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(Z)-2,2-dimethylpropylideneamino]benzamide is sourced from PubChem (CID 93116099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).