C22H24N2O2 — CID 9312035
(4S)-2-(3,4-dimethylphenyl)-4-(2-methylpropyliminomethyl)-4H-isoquinoline-1,3-dione (PubChem CID 9312035) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (4S)-2-(3,4-dimethylphenyl)-4-(2-methylpropyliminomethyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4S)-2-(3,4-dimethylphenyl)-4-(2-methylpropyliminomethyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312035 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (4S)-2-(3,4-dimethylphenyl)-4-(2-methylpropyliminomethyl)-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3[C@@H](/C=N/CC(C)C)C2=O)cc1C |
| InChI | InChI=1S/C22H24N2O2/c1-14(2)12-23-13-20-18-7-5-6-8-19(18)21(25)24(22(20)26)17-10-9-15(3)16(4)11-17/h5-11,13-14,20H,12H2,1-4H3/b23-13+/t20-/m1/s1 |
| InChIKey | ZCOSIMZMGODXRC-VMHRPQTGSA-N |
| XLogP | 4.30 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|