C24H29N3O3 — CID 93121827
1-[(2S)-4-cyclohexyl-2-ethyl-3-oxo-5H-1,4-benzoxazepin-7-yl]-3-phenylurea (PubChem CID 93121827) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[(2S)-4-cyclohexyl-2-ethyl-3-oxo-5H-1,4-benzoxazepin-7-yl]-3-phenylurea.
| Compound Name | 1-[(2S)-4-cyclohexyl-2-ethyl-3-oxo-5H-1,4-benzoxazepin-7-yl]-3-phenylurea |
|---|---|
| PubChem CID | 93121827 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[(2S)-4-cyclohexyl-2-ethyl-3-oxo-5H-1,4-benzoxazepin-7-yl]-3-phenylurea |
| SMILES | CC[C@@H]1Oc2ccc(NC(=O)Nc3ccccc3)cc2CN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C24H29N3O3/c1-2-21-23(28)27(20-11-7-4-8-12-20)16-17-15-19(13-14-22(17)30-21)26-24(29)25-18-9-5-3-6-10-18/h3,5-6,9-10,13-15,20-21H,2,4,7-8,11-12,16H2,1H3,(H2,25,26,29)/t21-/m0/s1 |
| InChIKey | QVIPZLSFPIBVAG-NRFANRHFSA-N |
| XLogP | 5.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |