C22H27N3O4 — CID 93121838
1-benzyl-3-[(2R)-4-(3-methoxypropyl)-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]urea (PubChem CID 93121838) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-benzyl-3-[(2R)-4-(3-methoxypropyl)-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]urea.
| Compound Name | 1-benzyl-3-[(2R)-4-(3-methoxypropyl)-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]urea |
|---|---|
| PubChem CID | 93121838 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-benzyl-3-[(2R)-4-(3-methoxypropyl)-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]urea |
| SMILES | COCCCN1Cc2cc(NC(=O)NCc3ccccc3)ccc2O[C@H](C)C1=O |
| InChI | InChI=1S/C22H27N3O4/c1-16-21(26)25(11-6-12-28-2)15-18-13-19(9-10-20(18)29-16)24-22(27)23-14-17-7-4-3-5-8-17/h3-5,7-10,13,16H,6,11-12,14-15H2,1-2H3,(H2,23,24,27)/t16-/m1/s1 |
| InChIKey | QPWOBTJETJMKOC-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|