C25H31N3O2 — CID 9312233
(4R)-4-[3-(tert-butylamino)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione (PubChem CID 9312233) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4R)-4-[3-(tert-butylamino)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione.
| Compound Name | (4R)-4-[3-(tert-butylamino)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9312233 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (4R)-4-[3-(tert-butylamino)propyliminomethyl]-2-(3,4-dimethylphenyl)-4H-isoquinoline-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/CCCNC(C)(C)C)C2=O)cc1C |
| InChI | InChI=1S/C25H31N3O2/c1-17-11-12-19(15-18(17)2)28-23(29)21-10-7-6-9-20(21)22(24(28)30)16-26-13-8-14-27-25(3,4)5/h6-7,9-12,15-16,22,27H,8,13-14H2,1-5H3/b26-16+/t22-/m0/s1 |
| InChIKey | KXWZAKKUXDERJD-SYOQMXFQSA-N |
| XLogP | 4.42 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|