C26H23ClN2O5 — CID 93124235
[2-[[(2R)-4-[(4-chlorophenyl)methyl]-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]carbamoyl]phenyl] acetate (PubChem CID 93124235) has the molecular formula C26H23ClN2O5 and a molecular weight of 478.93 g/mol. Its IUPAC name is [2-[[(2R)-4-[(4-chlorophenyl)methyl]-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[[(2R)-4-[(4-chlorophenyl)methyl]-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 93124235 |
| Molecular Formula | C26H23ClN2O5 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [2-[[(2R)-4-[(4-chlorophenyl)methyl]-2-methyl-3-oxo-5H-1,4-benzoxazepin-7-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ccc2c(c1)CN(Cc1ccc(Cl)cc1)C(=O)[C@@H](C)O2 |
| InChI | InChI=1S/C26H23ClN2O5/c1-16-26(32)29(14-18-7-9-20(27)10-8-18)15-19-13-21(11-12-23(19)33-16)28-25(31)22-5-3-4-6-24(22)34-17(2)30/h3-13,16H,14-15H2,1-2H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | CZEQPPHKYLDXQP-MRXNPFEDSA-N |
| XLogP | 4.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|