C25H22F3N3O2S — CID 93127885
N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 93127885) has the molecular formula C25H22F3N3O2S and a molecular weight of 485.53 g/mol. Its IUPAC name is N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 93127885 |
| Molecular Formula | C25H22F3N3O2S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[3-[(2R)-3-[4-(dimethylamino)phenyl]-4-oxo-1,3-thiazolidin-2-yl]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1ccc(N2C(=O)CS[C@@H]2c2cccc(NC(=O)c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C25H22F3N3O2S/c1-30(2)20-10-12-21(13-11-20)31-22(32)15-34-24(31)17-4-3-5-19(14-17)29-23(33)16-6-8-18(9-7-16)25(26,27)28/h3-14,24H,15H2,1-2H3,(H,29,33)/t24-/m1/s1 |
| InChIKey | WQLHAJDGONTMIZ-XMMPIXPASA-N |
| XLogP | 5.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|