C23H25NO6 — CID 9313411
(4Z)-2-(3,5-dimethoxyphenyl)-4-[[4-methoxy-3-(2-methylpropoxy)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 9313411) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (4Z)-2-(3,5-dimethoxyphenyl)-4-[[4-methoxy-3-(2-methylpropoxy)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,5-dimethoxyphenyl)-4-[[4-methoxy-3-(2-methylpropoxy)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313411 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (4Z)-2-(3,5-dimethoxyphenyl)-4-[[4-methoxy-3-(2-methylpropoxy)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(OC)cc(C2=N/C(=C\c3ccc(OC)c(OCC(C)C)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C23H25NO6/c1-14(2)13-29-21-9-15(6-7-20(21)28-5)8-19-23(25)30-22(24-19)16-10-17(26-3)12-18(11-16)27-4/h6-12,14H,13H2,1-5H3/b19-8- |
| InChIKey | JYXPQVRVVPYCRD-UWVJOHFNSA-N |
| XLogP | 4.09 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|