C20H27N3O3S — CID 93139305
ethyl (6S)-2-oxo-4-(piperidin-1-ylmethyl)-3-prop-2-enyl-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 93139305) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is ethyl (6S)-2-oxo-4-(piperidin-1-ylmethyl)-3-prop-2-enyl-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (6S)-2-oxo-4-(piperidin-1-ylmethyl)-3-prop-2-enyl-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 93139305 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | ethyl (6S)-2-oxo-4-(piperidin-1-ylmethyl)-3-prop-2-enyl-6-thiophen-3-yl-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CCN1C(=O)N[C@H](c2ccsc2)C(C(=O)OCC)=C1CN1CCCCC1 |
| InChI | InChI=1S/C20H27N3O3S/c1-3-9-23-16(13-22-10-6-5-7-11-22)17(19(24)26-4-2)18(21-20(23)25)15-8-12-27-14-15/h3,8,12,14,18H,1,4-7,9-11,13H2,2H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | MOAUFDDHVOOXKI-GOSISDBHSA-N |
| XLogP | 3.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|