C19H19ClN2O — CID 93143934
2-chloro-1-[(3S)-5-(3,4-dimethylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 93143934) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-chloro-1-[(3S)-5-(3,4-dimethylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[(3S)-5-(3,4-dimethylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 93143934 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-chloro-1-[(3S)-5-(3,4-dimethylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | Cc1ccc(C2=NN(C(=O)CCl)[C@H](c3ccccc3)C2)cc1C |
| InChI | InChI=1S/C19H19ClN2O/c1-13-8-9-16(10-14(13)2)17-11-18(15-6-4-3-5-7-15)22(21-17)19(23)12-20/h3-10,18H,11-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | YGLSSLAJQFKIQS-SFHVURJKSA-N |
| XLogP | 4.22 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|