C26H23F3N2O2 — CID 93148987
(3R,4R)-1-benzoyl-N-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 93148987) has the molecular formula C26H23F3N2O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is (3R,4R)-1-benzoyl-N-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-benzoyl-N-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93148987 |
| Molecular Formula | C26H23F3N2O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (3R,4R)-1-benzoyl-N-benzyl-4-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1CN(C(=O)c2ccccc2)C[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F3N2O2/c27-26(28,29)21-13-7-12-20(14-21)22-16-31(25(33)19-10-5-2-6-11-19)17-23(22)24(32)30-15-18-8-3-1-4-9-18/h1-14,22-23H,15-17H2,(H,30,32)/t22-,23-/m0/s1 |
| InChIKey | XGTZZEIPPXPGEO-GOTSBHOMSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |