C21H30N3O3S+ — CID 9315050
2-[[4-[(2,3-dimethylphenyl)sulfamoyl]benzoyl]amino]ethyl-diethylazanium (PubChem CID 9315050) has the molecular formula C21H30N3O3S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[[4-[(2,3-dimethylphenyl)sulfamoyl]benzoyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[4-[(2,3-dimethylphenyl)sulfamoyl]benzoyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 9315050 |
| Molecular Formula | C21H30N3O3S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[[4-[(2,3-dimethylphenyl)sulfamoyl]benzoyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1ccc(S(=O)(=O)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-5-24(6-2)15-14-22-21(25)18-10-12-19(13-11-18)28(26,27)23-20-9-7-8-16(3)17(20)4/h7-13,23H,5-6,14-15H2,1-4H3,(H,22,25)/p+1 |
| InChIKey | AHNINGCVBDTPNK-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |