C22H26N2O3 — CID 93150886
(3R,4R)-1-benzoyl-4-(3-methoxyphenyl)-N-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 93150886) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3R,4R)-1-benzoyl-4-(3-methoxyphenyl)-N-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-benzoyl-4-(3-methoxyphenyl)-N-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93150886 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3R,4R)-1-benzoyl-4-(3-methoxyphenyl)-N-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | COc1cccc([C@@H]2CN(C(=O)c3ccccc3)C[C@@H]2C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-15(2)23-21(25)20-14-24(22(26)16-8-5-4-6-9-16)13-19(20)17-10-7-11-18(12-17)27-3/h4-12,15,19-20H,13-14H2,1-3H3,(H,23,25)/t19-,20-/m0/s1 |
| InChIKey | ZJANCYMGOYHNCM-PMACEKPBSA-N |
| XLogP | 3.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |