C15H18N2O2S — CID 93158707
N-[(2S)-butan-2-yl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide (PubChem CID 93158707) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 93158707 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1csc(COc2ccccc2)n1 |
| InChI | InChI=1S/C15H18N2O2S/c1-3-11(2)16-15(18)13-10-20-14(17-13)9-19-12-7-5-4-6-8-12/h4-8,10-11H,3,9H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | FPNNZYCFEQNVKC-NSHDSACASA-N |
| XLogP | 3.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |