C18H29NO3 — CID 93160585
(2S)-1-[(4-methoxyphenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol (PubChem CID 93160585) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2S)-1-[(4-methoxyphenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(4-methoxyphenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93160585 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2S)-1-[(4-methoxyphenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(CCCOC)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H29NO3/c1-4-5-7-17(20)15-19(12-6-13-21-2)14-16-8-10-18(22-3)11-9-16/h4,8-11,17,20H,1,5-7,12-15H2,2-3H3/t17-/m0/s1 |
| InChIKey | PJYDREJVUNFCEQ-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|