C15H11FN3O5- — CID 9316823
4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 9316823) has the molecular formula C15H11FN3O5- and a molecular weight of 332.27 g/mol. Its IUPAC name is 4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 9316823 |
| Molecular Formula | C15H11FN3O5- |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-[(Z)-[[2-(2-fluorophenoxy)acetyl]hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | O=C(COc1ccccc1F)N/N=C\c1ccc([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12FN3O5/c16-11-3-1-2-4-14(11)24-9-15(21)18-17-8-10-5-6-13(20)12(7-10)19(22)23/h1-8,20H,9H2,(H,18,21)/p-1/b17-8- |
| InChIKey | HBJOGTVYJYXBQY-IUXPMGMMSA-M |
| XLogP | 1.34 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|