C22H27N3O3S — CID 93171921
3-ethyl-1-[2-oxo-2-[(4S)-4-(phenoxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]-1-prop-2-enylurea (PubChem CID 93171921) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-ethyl-1-[2-oxo-2-[(4S)-4-(phenoxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]-1-prop-2-enylurea.
| Compound Name | 3-ethyl-1-[2-oxo-2-[(4S)-4-(phenoxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 93171921 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 3-ethyl-1-[2-oxo-2-[(4S)-4-(phenoxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]-1-prop-2-enylurea |
| SMILES | C=CCN(CC(=O)N1CCc2sccc2[C@H]1COc1ccccc1)C(=O)NCC |
| InChI | InChI=1S/C22H27N3O3S/c1-3-12-24(22(27)23-4-2)15-21(26)25-13-10-20-18(11-14-29-20)19(25)16-28-17-8-6-5-7-9-17/h3,5-9,11,14,19H,1,4,10,12-13,15-16H2,2H3,(H,23,27)/t19-/m1/s1 |
| InChIKey | IBROJTITJYMQGX-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|