C13H23N3O2 — CID 93173904
N-methyl-1-[(2R)-piperidine-2-carbonyl]piperidine-4-carboxamide (PubChem CID 93173904) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-methyl-1-[(2R)-piperidine-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-methyl-1-[(2R)-piperidine-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 93173904 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-methyl-1-[(2R)-piperidine-2-carbonyl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)[C@H]2CCCCN2)CC1 |
| InChI | InChI=1S/C13H23N3O2/c1-14-12(17)10-5-8-16(9-6-10)13(18)11-4-2-3-7-15-11/h10-11,15H,2-9H2,1H3,(H,14,17)/t11-/m1/s1 |
| InChIKey | DWEUJAICJCVPEP-LLVKDONJSA-N |
| XLogP | 0.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |