C17H14O5 — CID 93179406
4-[(2R)-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl]benzoic acid (PubChem CID 93179406) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 4-[(2R)-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl]benzoic acid.
| Compound Name | 4-[(2R)-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 93179406 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[(2R)-7-methoxy-4-oxo-2,3-dihydrochromen-2-yl]benzoic acid |
| SMILES | COc1ccc2c(c1)O[C@@H](c1ccc(C(=O)O)cc1)CC2=O |
| InChI | InChI=1S/C17H14O5/c1-21-12-6-7-13-14(18)9-15(22-16(13)8-12)10-2-4-11(5-3-10)17(19)20/h2-8,15H,9H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | FRUISQDBHQZCGO-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |