C20H24N2O4 — CID 9318169
N-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]phenyl]-2-methoxybenzamide (PubChem CID 9318169) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 9318169 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[4-[2-[[(2R)-butan-2-yl]amino]-2-oxoethoxy]phenyl]-2-methoxybenzamide |
| SMILES | CC[C@@H](C)NC(=O)COc1ccc(NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-4-14(2)21-19(23)13-26-16-11-9-15(10-12-16)22-20(24)17-7-5-6-8-18(17)25-3/h5-12,14H,4,13H2,1-3H3,(H,21,23)(H,22,24)/t14-/m1/s1 |
| InChIKey | SXHLFEDTQAWCRA-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |