About cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium
cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9318181) has the molecular formula C21H25N2O2+
and a molecular weight of 337.44 g/mol. Its IUPAC name is cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium.
Molecular Properties
| Compound Name | cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium |
| PubChem CID | 9318181 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](Cn2c(=O)oc3ccccc32)C2CC2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-15(2)17-9-7-16(8-10-17)13-22(18-11-12-18)14-23-19-5-3-4-6-20(19)25-21(23)24/h3-10,15,18H,11-14H2,1-2H3/p+1 |
| InChIKey | INHVTKSOWIPXDN-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The IUPAC name of cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium (CID 9318181) is cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium.
What is the SMILES notation for cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The canonical SMILES for cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium is CC(C)c1ccc(C[NH+](Cn2c(=O)oc3ccccc32)C2CC2)cc1.
What is the InChIKey of cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
The InChIKey is INHVTKSOWIPXDN-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H24N2O2/c1-15(2)17-9-7-16(8-10-17)13-22(18-11-12-18)14-23-19-5-3-4-6-20(19)25-21(23)24/h3-10,15,18H,11-14H2,1-2H3/p+1.
What are the key properties of cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium?
cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium has a molecular weight of 337.44 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[(2-oxo-1,3-benzoxazol-3-yl)methyl]-[(4-propan-2-ylphenyl)methyl]azanium is sourced from PubChem (CID 9318181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).