C21H28N4OS — CID 9318554
2-[[(6-methoxynaphthalen-2-yl)methyl-methylamino]methyl]-4-pentyl-1,2,4-triazole-3-thione (PubChem CID 9318554) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-[[(6-methoxynaphthalen-2-yl)methyl-methylamino]methyl]-4-pentyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(6-methoxynaphthalen-2-yl)methyl-methylamino]methyl]-4-pentyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9318554 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[[(6-methoxynaphthalen-2-yl)methyl-methylamino]methyl]-4-pentyl-1,2,4-triazole-3-thione |
| SMILES | CCCCCn1cnn(CN(C)Cc2ccc3cc(OC)ccc3c2)c1=S |
| InChI | InChI=1S/C21H28N4OS/c1-4-5-6-11-24-15-22-25(21(24)27)16-23(2)14-17-7-8-19-13-20(26-3)10-9-18(19)12-17/h7-10,12-13,15H,4-6,11,14,16H2,1-3H3 |
| InChIKey | NRPNZFYNVXWKPC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|