About 2-thiocyanatoethyl dodecanoate
2-thiocyanatoethyl dodecanoate (PubChem CID 9319) has the molecular formula C15H27NO2S
and a molecular weight of 285.45 g/mol. Its IUPAC name is 2-thiocyanatoethyl dodecanoate.
Molecular Properties
| Compound Name | 2-thiocyanatoethyl dodecanoate |
| PubChem CID | 9319 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-thiocyanatoethyl dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCCSC#N |
| InChI | InChI=1S/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-15(17)18-12-13-19-14-16/h2-13H2,1H3 |
| InChIKey | DXTLBEQSVNRVKT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-thiocyanatoethyl dodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiocyanatoethyl dodecanoate?
The IUPAC name of 2-thiocyanatoethyl dodecanoate (CID 9319) is 2-thiocyanatoethyl dodecanoate.
What is the SMILES notation for 2-thiocyanatoethyl dodecanoate?
The canonical SMILES for 2-thiocyanatoethyl dodecanoate is CCCCCCCCCCCC(=O)OCCSC#N.
What is the InChIKey of 2-thiocyanatoethyl dodecanoate?
The InChIKey is DXTLBEQSVNRVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-15(17)18-12-13-19-14-16/h2-13H2,1H3.
What are the key properties of 2-thiocyanatoethyl dodecanoate?
2-thiocyanatoethyl dodecanoate has a molecular weight of 285.45 g/mol, XLogP of 4.66, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiocyanatoethyl dodecanoate is sourced from PubChem (CID 9319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).