C12H16N3O3S+ — CID 9319072
(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 9319072) has the molecular formula C12H16N3O3S+ and a molecular weight of 282.34 g/mol. Its IUPAC name is (3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | (3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9319072 |
| Molecular Formula | C12H16N3O3S+ |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | CCN1C(=O)C(=O)N(C[NH+](C)Cc2ccsc2)C1=O |
| InChI | InChI=1S/C12H15N3O3S/c1-3-14-10(16)11(17)15(12(14)18)8-13(2)6-9-4-5-19-7-9/h4-5,7H,3,6,8H2,1-2H3/p+1 |
| InChIKey | SVJQOORWVGLDQY-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|