About 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid
1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 9319232) has the molecular formula C22H17N3O4
and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid |
| PubChem CID | 9319232 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | Cn1c(=O)c2c(C(=O)O)cc(-c3ccccc3)nc2n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H17N3O4/c1-24-20(26)18-16(21(27)28)12-17(15-10-6-3-7-11-15)23-19(18)25(22(24)29)13-14-8-4-2-5-9-14/h2-12H,13H2,1H3,(H,27,28) |
| InChIKey | LVUKPTJQTQJUIC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid?
The IUPAC name of 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid (CID 9319232) is 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid?
The canonical SMILES for 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid is Cn1c(=O)c2c(C(=O)O)cc(-c3ccccc3)nc2n(Cc2ccccc2)c1=O.
What is the InChIKey of 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid?
The InChIKey is LVUKPTJQTQJUIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O4/c1-24-20(26)18-16(21(27)28)12-17(15-10-6-3-7-11-15)23-19(18)25(22(24)29)13-14-8-4-2-5-9-14/h2-12H,13H2,1H3,(H,27,28).
What are the key properties of 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid?
1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid has a molecular weight of 387.40 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 9319232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).