C26H33N3O3S — CID 93196155
2-[[cyclohexyl-[(2R)-2-hydroxyhex-5-enyl]amino]methyl]-5-(3-methoxyphenyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 93196155) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is 2-[[cyclohexyl-[(2R)-2-hydroxyhex-5-enyl]amino]methyl]-5-(3-methoxyphenyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[cyclohexyl-[(2R)-2-hydroxyhex-5-enyl]amino]methyl]-5-(3-methoxyphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 93196155 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[[cyclohexyl-[(2R)-2-hydroxyhex-5-enyl]amino]methyl]-5-(3-methoxyphenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCC[C@@H](O)CN(Cc1nc2scc(-c3cccc(OC)c3)c2c(=O)[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C26H33N3O3S/c1-3-4-12-20(30)15-29(19-10-6-5-7-11-19)16-23-27-25(31)24-22(17-33-26(24)28-23)18-9-8-13-21(14-18)32-2/h3,8-9,13-14,17,19-20,30H,1,4-7,10-12,15-16H2,2H3,(H,27,28,31)/t20-/m1/s1 |
| InChIKey | TVCZYTYWUCGAFP-HXUWFJFHSA-N |
| XLogP | 5.12 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|