C22H33N3O4 — CID 93197391
N-[(1R)-2-(diethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]-4-methoxybenzamide (PubChem CID 93197391) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[(1R)-2-(diethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]-4-methoxybenzamide.
| Compound Name | N-[(1R)-2-(diethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 93197391 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[(1R)-2-(diethylamino)-2-oxo-1-(1-propanoylpiperidin-4-yl)ethyl]-4-methoxybenzamide |
| SMILES | CCC(=O)N1CCC([C@@H](NC(=O)c2ccc(OC)cc2)C(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-5-19(26)25-14-12-16(13-15-25)20(22(28)24(6-2)7-3)23-21(27)17-8-10-18(29-4)11-9-17/h8-11,16,20H,5-7,12-15H2,1-4H3,(H,23,27)/t20-/m1/s1 |
| InChIKey | IHBJRENEPGPQDO-HXUWFJFHSA-N |
| XLogP | 2.31 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |