C22H32N4O4S — CID 93200450
N-[(1S)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methylpropylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 93200450) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[(1S)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methylpropylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(1S)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methylpropylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 93200450 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[(1S)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methylpropylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCNC(=S)N1CCC([C@H](NC(=O)c2ccc3c(c2)OCO3)C(=O)NCC(C)C)CC1 |
| InChI | InChI=1S/C22H32N4O4S/c1-4-23-22(31)26-9-7-15(8-10-26)19(21(28)24-12-14(2)3)25-20(27)16-5-6-17-18(11-16)30-13-29-17/h5-6,11,14-15,19H,4,7-10,12-13H2,1-3H3,(H,23,31)(H,24,28)(H,25,27)/t19-/m0/s1 |
| InChIKey | PIXILSHYWUQNJM-IBGZPJMESA-N |
| XLogP | 1.89 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|