C18H16N2O3 — CID 93203846
8-(2-methylprop-2-enoxy)-2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 93203846) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 8-(2-methylprop-2-enoxy)-2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid.
| Compound Name | 8-(2-methylprop-2-enoxy)-2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 93203846 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 8-(2-methylprop-2-enoxy)-2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid |
| SMILES | C=C(C)COc1cccn2c(C(=O)O)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H16N2O3/c1-12(2)11-23-14-9-6-10-20-16(18(21)22)15(19-17(14)20)13-7-4-3-5-8-13/h3-10H,1,11H2,2H3,(H,21,22) |
| InChIKey | DIUJGKKYTXNTDQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|