C18H17N3O4 — CID 9320938
2-(1,2-benzoxazol-3-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide (PubChem CID 9320938) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9320938 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N'-[2-(2-methylphenoxy)acetyl]acetohydrazide |
| SMILES | Cc1ccccc1OCC(=O)NNC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C18H17N3O4/c1-12-6-2-4-8-15(12)24-11-18(23)20-19-17(22)10-14-13-7-3-5-9-16(13)25-21-14/h2-9H,10-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | IFXPMFDWWSFMET-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|