C27H32ClN3O3 — CID 93217940
(2R)-1-[[5-(2-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(cyclopropylmethyl)amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93217940) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is (2R)-1-[[5-(2-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(cyclopropylmethyl)amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[[5-(2-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(cyclopropylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93217940 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (2R)-1-[[5-(2-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(cyclopropylmethyl)amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccccc1Cl)CC1CC1 |
| InChI | InChI=1S/C27H32ClN3O3/c1-3-15-33-19-23(32)17-30(16-21-13-14-21)18-24-20(2)29-31(22-9-5-4-6-10-22)27(24)34-26-12-8-7-11-25(26)28/h3-12,21,23,32H,1,13-19H2,2H3/t23-/m1/s1 |
| InChIKey | RBKRJUNWDXYVEM-HSZRJFAPSA-N |
| XLogP | 5.40 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|