C21H21FN4O3 — CID 9321843
N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 9321843) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 9321843 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)Cn1c(=O)cnc2ccccc21 |
| InChI | InChI=1S/C21H21FN4O3/c1-2-25(13-19(27)24-11-15-7-9-16(22)10-8-15)21(29)14-26-18-6-4-3-5-17(18)23-12-20(26)28/h3-10,12H,2,11,13-14H2,1H3,(H,24,27) |
| InChIKey | YFZGYYPRCHWWBK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |