C18H29N3O2 — CID 93218970
1-(3-amino-4-ethoxyphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-1-one (PubChem CID 93218970) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(3-amino-4-ethoxyphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-1-one.
| Compound Name | 1-(3-amino-4-ethoxyphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-1-one |
|---|---|
| PubChem CID | 93218970 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-(3-amino-4-ethoxyphenyl)-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-1-one |
| SMILES | CCOc1ccc(C(=O)CCN(C)C2CCN(C)CC2)cc1N |
| InChI | InChI=1S/C18H29N3O2/c1-4-23-18-6-5-14(13-16(18)19)17(22)9-12-21(3)15-7-10-20(2)11-8-15/h5-6,13,15H,4,7-12,19H2,1-3H3 |
| InChIKey | JCRGPNSBKOWXQQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|