C26H31N3O3 — CID 93219972
(2R)-1-[cyclopropyl-[(1-methyl-5-phenoxy-3-phenylpyrazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93219972) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2R)-1-[cyclopropyl-[(1-methyl-5-phenoxy-3-phenylpyrazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[cyclopropyl-[(1-methyl-5-phenoxy-3-phenylpyrazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93219972 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (2R)-1-[cyclopropyl-[(1-methyl-5-phenoxy-3-phenylpyrazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(Cc1c(-c2ccccc2)nn(C)c1Oc1ccccc1)C1CC1 |
| InChI | InChI=1S/C26H31N3O3/c1-3-16-31-19-22(30)17-29(21-14-15-21)18-24-25(20-10-6-4-7-11-20)27-28(2)26(24)32-23-12-8-5-9-13-23/h3-13,21-22,30H,1,14-19H2,2H3/t22-/m1/s1 |
| InChIKey | VIWBFXZZAABGEH-JOCHJYFZSA-N |
| XLogP | 4.41 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|