C26H35FN2O4S — CID 93221041
1-[(4R)-4-[(4-fluorophenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-[[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)amino]ethanone (PubChem CID 93221041) has the molecular formula C26H35FN2O4S and a molecular weight of 490.64 g/mol. Its IUPAC name is 1-[(4R)-4-[(4-fluorophenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-[[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)amino]ethanone.
| Compound Name | 1-[(4R)-4-[(4-fluorophenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-[[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)amino]ethanone |
|---|---|
| PubChem CID | 93221041 |
| Molecular Formula | C26H35FN2O4S |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-[(4R)-4-[(4-fluorophenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-[[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)amino]ethanone |
| SMILES | C=CCC[C@H](O)CN(CCCOC)CC(=O)N1CCc2sccc2[C@@H]1COc1ccc(F)cc1 |
| InChI | InChI=1S/C26H35FN2O4S/c1-3-4-6-21(30)17-28(13-5-15-32-2)18-26(31)29-14-11-25-23(12-16-34-25)24(29)19-33-22-9-7-20(27)8-10-22/h3,7-10,12,16,21,24,30H,1,4-6,11,13-15,17-19H2,2H3/t21-,24-/m0/s1 |
| InChIKey | YZQWEOZOANQMAQ-URXFXBBRSA-N |
| XLogP | 4.06 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|