C22H30ClN3O2 — CID 93221645
(2R)-N-(4-chlorophenyl)-2-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-cyclopentylacetamide (PubChem CID 93221645) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-cyclopentylacetamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 93221645 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[4-(cyclobutanecarbonyl)piperazin-1-yl]-2-cyclopentylacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)[C@@H](C1CCCC1)N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C22H30ClN3O2/c23-18-8-10-19(11-9-18)24-21(27)20(16-4-1-2-5-16)25-12-14-26(15-13-25)22(28)17-6-3-7-17/h8-11,16-17,20H,1-7,12-15H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | QDTPWEIGDKLBNZ-HXUWFJFHSA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |