C18H17ClNO5S- — CID 9322415
2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-4,5-dimethoxybenzoate (PubChem CID 9322415) has the molecular formula C18H17ClNO5S- and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | 2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 9322415 |
| Molecular Formula | C18H17ClNO5S- |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)CSCc2ccccc2Cl)c(C(=O)[O-])cc1OC |
| InChI | InChI=1S/C18H18ClNO5S/c1-24-15-7-12(18(22)23)14(8-16(15)25-2)20-17(21)10-26-9-11-5-3-4-6-13(11)19/h3-8H,9-10H2,1-2H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | JCXBUOMYJKBJIQ-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |