C20H22ClN4S2+ — CID 9322986
5-(2-chlorophenyl)-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 9322986) has the molecular formula C20H22ClN4S2+ and a molecular weight of 418.01 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-chlorophenyl)-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9322986 |
| Molecular Formula | C20H22ClN4S2+ |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[[(4S)-4-cyclopropyl-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccccc2Cl)nn(C[NH+]2CCc3sccc3[C@@H]2C2CC2)c1=S |
| InChI | InChI=1S/C20H21ClN4S2/c1-23-19(14-4-2-3-5-16(14)21)22-25(20(23)26)12-24-10-8-17-15(9-11-27-17)18(24)13-6-7-13/h2-5,9,11,13,18H,6-8,10,12H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | RSDFBYDCCKGBJQ-SFHVURJKSA-O |
| XLogP | 3.88 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|