C24H32N4O4 — CID 93239203
1-[(5aR,9aR)-1-(3,4-dimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-[1,2,4]triazolo[4,3-a]quinoxalin-5-yl]-3-[(2S)-oxolan-2-yl]propan-1-one (PubChem CID 93239203) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-[(5aR,9aR)-1-(3,4-dimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-[1,2,4]triazolo[4,3-a]quinoxalin-5-yl]-3-[(2S)-oxolan-2-yl]propan-1-one.
| Compound Name | 1-[(5aR,9aR)-1-(3,4-dimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-[1,2,4]triazolo[4,3-a]quinoxalin-5-yl]-3-[(2S)-oxolan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 93239203 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-[(5aR,9aR)-1-(3,4-dimethoxyphenyl)-5a,6,7,8,9,9a-hexahydro-4H-[1,2,4]triazolo[4,3-a]quinoxalin-5-yl]-3-[(2S)-oxolan-2-yl]propan-1-one |
| SMILES | COc1ccc(-c2nnc3n2[C@@H]2CCCC[C@H]2N(C(=O)CC[C@@H]2CCCO2)C3)cc1OC |
| InChI | InChI=1S/C24H32N4O4/c1-30-20-11-9-16(14-21(20)31-2)24-26-25-22-15-27(18-7-3-4-8-19(18)28(22)24)23(29)12-10-17-6-5-13-32-17/h9,11,14,17-19H,3-8,10,12-13,15H2,1-2H3/t17-,18+,19+/m0/s1 |
| InChIKey | RFXMNLCSUYOOCS-IPMKNSEASA-N |
| XLogP | 3.75 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |