C21H25N5O3 — CID 93242265
2-[(4R)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(1-methyl-5-phenylimidazol-2-yl)acetamide (PubChem CID 93242265) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(4R)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(1-methyl-5-phenylimidazol-2-yl)acetamide.
| Compound Name | 2-[(4R)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(1-methyl-5-phenylimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 93242265 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[(4R)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(1-methyl-5-phenylimidazol-2-yl)acetamide |
| SMILES | Cn1c(-c2ccccc2)cnc1NC(=O)C[C@H]1NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C21H25N5O3/c1-25-17(14-8-4-2-5-9-14)13-22-20(25)24-18(27)12-16-19(28)26(21(29)23-16)15-10-6-3-7-11-15/h2,4-5,8-9,13,15-16H,3,6-7,10-12H2,1H3,(H,23,29)(H,22,24,27)/t16-/m1/s1 |
| InChIKey | ZRLUBESZLCSFKD-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|