C23H25N3O2S — CID 93242561
N-[(S)-[(3S)-1-(4-methoxyphenyl)piperidin-3-yl]-pyridin-2-ylmethyl]thiophene-2-carboxamide (PubChem CID 93242561) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(S)-[(3S)-1-(4-methoxyphenyl)piperidin-3-yl]-pyridin-2-ylmethyl]thiophene-2-carboxamide.
| Compound Name | N-[(S)-[(3S)-1-(4-methoxyphenyl)piperidin-3-yl]-pyridin-2-ylmethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 93242561 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[(S)-[(3S)-1-(4-methoxyphenyl)piperidin-3-yl]-pyridin-2-ylmethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(N2CCC[C@H]([C@H](NC(=O)c3cccs3)c3ccccn3)C2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-28-19-11-9-18(10-12-19)26-14-4-6-17(16-26)22(20-7-2-3-13-24-20)25-23(27)21-8-5-15-29-21/h2-3,5,7-13,15,17,22H,4,6,14,16H2,1H3,(H,25,27)/t17-,22-/m0/s1 |
| InChIKey | IELOPBSCEQHMRT-JTSKRJEESA-N |
| XLogP | 4.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|